C21H23N3O5 — CID 30679617
N'-(2-methoxy-5-methylphenyl)-N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]oxamide (PubChem CID 30679617) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is N'-(2-methoxy-5-methylphenyl)-N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]oxamide.
| Compound Name | N'-(2-methoxy-5-methylphenyl)-N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 30679617 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N'-(2-methoxy-5-methylphenyl)-N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]oxamide |
| SMILES | COc1ccc(C)cc1NC(=O)C(=O)Nc1ccc(OC)c(N2CCCC2=O)c1 |
| InChI | InChI=1S/C21H23N3O5/c1-13-6-8-17(28-2)15(11-13)23-21(27)20(26)22-14-7-9-18(29-3)16(12-14)24-10-4-5-19(24)25/h6-9,11-12H,4-5,10H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | KEKMXQIXRZRJFA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|