C16H20N2O6 — CID 146136090
2-methoxy-3-[4-methoxy-3-(2-oxopyrrolidin-1-yl)anilino]-2-methyl-3-oxopropanoic acid (PubChem CID 146136090) has the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. Its IUPAC name is 2-methoxy-3-[4-methoxy-3-(2-oxopyrrolidin-1-yl)anilino]-2-methyl-3-oxopropanoic acid.
| Compound Name | 2-methoxy-3-[4-methoxy-3-(2-oxopyrrolidin-1-yl)anilino]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 146136090 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-methoxy-3-[4-methoxy-3-(2-oxopyrrolidin-1-yl)anilino]-2-methyl-3-oxopropanoic acid |
| SMILES | COc1ccc(NC(=O)C(C)(OC)C(=O)O)cc1N1CCCC1=O |
| InChI | InChI=1S/C16H20N2O6/c1-16(24-3,15(21)22)14(20)17-10-6-7-12(23-2)11(9-10)18-8-4-5-13(18)19/h6-7,9H,4-5,8H2,1-3H3,(H,17,20)(H,21,22) |
| InChIKey | CFWDQUWTGWXKBF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|