C21H22ClN3O4 — CID 44901794
N'-(5-chloro-2-methoxyphenyl)-N-[4-methyl-3-(2-oxopiperidin-1-yl)phenyl]oxamide (PubChem CID 44901794) has the molecular formula C21H22ClN3O4 and a molecular weight of 415.88 g/mol. Its IUPAC name is N'-(5-chloro-2-methoxyphenyl)-N-[4-methyl-3-(2-oxopiperidin-1-yl)phenyl]oxamide.
| Compound Name | N'-(5-chloro-2-methoxyphenyl)-N-[4-methyl-3-(2-oxopiperidin-1-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 44901794 |
| Molecular Formula | C21H22ClN3O4 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | N'-(5-chloro-2-methoxyphenyl)-N-[4-methyl-3-(2-oxopiperidin-1-yl)phenyl]oxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(=O)Nc1ccc(C)c(N2CCCCC2=O)c1 |
| InChI | InChI=1S/C21H22ClN3O4/c1-13-6-8-15(12-17(13)25-10-4-3-5-19(25)26)23-20(27)21(28)24-16-11-14(22)7-9-18(16)29-2/h6-9,11-12H,3-5,10H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | IEVKMUDQHWUOKM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|