C21H22FN3O3 — CID 30680066
N'-(3-fluoro-4-methylphenyl)-N-[4-methyl-3-(2-oxopiperidin-1-yl)phenyl]oxamide (PubChem CID 30680066) has the molecular formula C21H22FN3O3 and a molecular weight of 383.42 g/mol. Its IUPAC name is N'-(3-fluoro-4-methylphenyl)-N-[4-methyl-3-(2-oxopiperidin-1-yl)phenyl]oxamide.
| Compound Name | N'-(3-fluoro-4-methylphenyl)-N-[4-methyl-3-(2-oxopiperidin-1-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 30680066 |
| Molecular Formula | C21H22FN3O3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N'-(3-fluoro-4-methylphenyl)-N-[4-methyl-3-(2-oxopiperidin-1-yl)phenyl]oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)Nc2ccc(C)c(N3CCCCC3=O)c2)cc1F |
| InChI | InChI=1S/C21H22FN3O3/c1-13-6-8-15(11-17(13)22)23-20(27)21(28)24-16-9-7-14(2)18(12-16)25-10-4-3-5-19(25)26/h6-9,11-12H,3-5,10H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | RNHIISQVTZNSPT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|