C17H14ClFN2O2 — CID 17487375
2-chloro-4-fluoro-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzamide (PubChem CID 17487375) has the molecular formula C17H14ClFN2O2 and a molecular weight of 332.76 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzamide.
| Compound Name | 2-chloro-4-fluoro-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 17487375 |
| Molecular Formula | C17H14ClFN2O2 |
| Molecular Weight | 332.76 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 2-chloro-4-fluoro-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(N2CCCC2=O)c1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H14ClFN2O2/c18-15-9-11(19)6-7-14(15)17(23)20-12-3-1-4-13(10-12)21-8-2-5-16(21)22/h1,3-4,6-7,9-10H,2,5,8H2,(H,20,23) |
| InChIKey | AKEGADVIBQEYLA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.76 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |