C24H19ClN4O5 — CID 55396013
2-chloro-4-nitro-N-[2-[[3-(2-oxopyrrolidin-1-yl)phenyl]carbamoyl]phenyl]benzamide (PubChem CID 55396013) has the molecular formula C24H19ClN4O5 and a molecular weight of 478.89 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-[2-[[3-(2-oxopyrrolidin-1-yl)phenyl]carbamoyl]phenyl]benzamide.
| Compound Name | 2-chloro-4-nitro-N-[2-[[3-(2-oxopyrrolidin-1-yl)phenyl]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 55396013 |
| Molecular Formula | C24H19ClN4O5 |
| Molecular Weight | 478.89 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 2-chloro-4-nitro-N-[2-[[3-(2-oxopyrrolidin-1-yl)phenyl]carbamoyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)Nc1cccc(N2CCCC2=O)c1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C24H19ClN4O5/c25-20-14-17(29(33)34)10-11-18(20)23(31)27-21-8-2-1-7-19(21)24(32)26-15-5-3-6-16(13-15)28-12-4-9-22(28)30/h1-3,5-8,10-11,13-14H,4,9,12H2,(H,26,32)(H,27,31) |
| InChIKey | WMCGSWWLTCHWCB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.89 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|