C22H15ClN4O6 — CID 24674094
2-chloro-4-nitro-N-[2-[(3-oxo-4H-1,4-benzoxazin-6-yl)carbamoyl]phenyl]benzamide (PubChem CID 24674094) has the molecular formula C22H15ClN4O6 and a molecular weight of 466.84 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-[2-[(3-oxo-4H-1,4-benzoxazin-6-yl)carbamoyl]phenyl]benzamide.
| Compound Name | 2-chloro-4-nitro-N-[2-[(3-oxo-4H-1,4-benzoxazin-6-yl)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 24674094 |
| Molecular Formula | C22H15ClN4O6 |
| Molecular Weight | 466.84 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 2-chloro-4-nitro-N-[2-[(3-oxo-4H-1,4-benzoxazin-6-yl)carbamoyl]phenyl]benzamide |
| SMILES | O=C1COc2ccc(NC(=O)c3ccccc3NC(=O)c3ccc([N+](=O)[O-])cc3Cl)cc2N1 |
| InChI | InChI=1S/C22H15ClN4O6/c23-16-10-13(27(31)32)6-7-14(16)21(29)26-17-4-2-1-3-15(17)22(30)24-12-5-8-19-18(9-12)25-20(28)11-33-19/h1-10H,11H2,(H,24,30)(H,25,28)(H,26,29) |
| InChIKey | LTYCGABJZQAFOR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.84 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|