C15H10ClN3O5 — CID 35529834
4-chloro-3-nitro-N-(3-oxo-4H-1,4-benzoxazin-6-yl)benzamide (PubChem CID 35529834) has the molecular formula C15H10ClN3O5 and a molecular weight of 347.71 g/mol. Its IUPAC name is 4-chloro-3-nitro-N-(3-oxo-4H-1,4-benzoxazin-6-yl)benzamide.
| Compound Name | 4-chloro-3-nitro-N-(3-oxo-4H-1,4-benzoxazin-6-yl)benzamide |
|---|---|
| PubChem CID | 35529834 |
| Molecular Formula | C15H10ClN3O5 |
| Molecular Weight | 347.71 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 4-chloro-3-nitro-N-(3-oxo-4H-1,4-benzoxazin-6-yl)benzamide |
| SMILES | O=C1COc2ccc(NC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)cc2N1 |
| InChI | InChI=1S/C15H10ClN3O5/c16-10-3-1-8(5-12(10)19(22)23)15(21)17-9-2-4-13-11(6-9)18-14(20)7-24-13/h1-6H,7H2,(H,17,21)(H,18,20) |
| InChIKey | LNZTYNATSRLVKO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.71 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|