C16H12ClN3O4 — CID 154751414
3-chloro-4-nitro-N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)benzamide (PubChem CID 154751414) has the molecular formula C16H12ClN3O4 and a molecular weight of 345.74 g/mol. Its IUPAC name is 3-chloro-4-nitro-N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)benzamide.
| Compound Name | 3-chloro-4-nitro-N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)benzamide |
|---|---|
| PubChem CID | 154751414 |
| Molecular Formula | C16H12ClN3O4 |
| Molecular Weight | 345.74 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 3-chloro-4-nitro-N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)benzamide |
| SMILES | O=C1CCc2ccc(NC(=O)c3ccc([N+](=O)[O-])c(Cl)c3)cc2N1 |
| InChI | InChI=1S/C16H12ClN3O4/c17-12-7-10(2-5-14(12)20(23)24)16(22)18-11-4-1-9-3-6-15(21)19-13(9)8-11/h1-2,4-5,7-8H,3,6H2,(H,18,22)(H,19,21) |
| InChIKey | KPVINFRFTKFITL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.74 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|