C18H16ClN3O5 — CID 40887786
2-chloro-N-(3,3-dimethyl-4-oxo-2,5-dihydro-1,5-benzoxazepin-7-yl)-4-nitrobenzamide (PubChem CID 40887786) has the molecular formula C18H16ClN3O5 and a molecular weight of 389.80 g/mol. Its IUPAC name is 2-chloro-N-(3,3-dimethyl-4-oxo-2,5-dihydro-1,5-benzoxazepin-7-yl)-4-nitrobenzamide.
| Compound Name | 2-chloro-N-(3,3-dimethyl-4-oxo-2,5-dihydro-1,5-benzoxazepin-7-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 40887786 |
| Molecular Formula | C18H16ClN3O5 |
| Molecular Weight | 389.80 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 2-chloro-N-(3,3-dimethyl-4-oxo-2,5-dihydro-1,5-benzoxazepin-7-yl)-4-nitrobenzamide |
| SMILES | CC1(C)COc2ccc(NC(=O)c3ccc([N+](=O)[O-])cc3Cl)cc2NC1=O |
| InChI | InChI=1S/C18H16ClN3O5/c1-18(2)9-27-15-6-3-10(7-14(15)21-17(18)24)20-16(23)12-5-4-11(22(25)26)8-13(12)19/h3-8H,9H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | TXHUZDNFSGFGOI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.80 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|