C20H21N3O3S — CID 121054638
N'-(2-methylsulfanylphenyl)-N-[3-(2-oxopiperidin-1-yl)phenyl]oxamide (PubChem CID 121054638) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is N'-(2-methylsulfanylphenyl)-N-[3-(2-oxopiperidin-1-yl)phenyl]oxamide.
| Compound Name | N'-(2-methylsulfanylphenyl)-N-[3-(2-oxopiperidin-1-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 121054638 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N'-(2-methylsulfanylphenyl)-N-[3-(2-oxopiperidin-1-yl)phenyl]oxamide |
| SMILES | CSc1ccccc1NC(=O)C(=O)Nc1cccc(N2CCCCC2=O)c1 |
| InChI | InChI=1S/C20H21N3O3S/c1-27-17-10-3-2-9-16(17)22-20(26)19(25)21-14-7-6-8-15(13-14)23-12-5-4-11-18(23)24/h2-3,6-10,13H,4-5,11-12H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | NRKUFMSQCBQWQS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|