C17H18N2O3S2 — CID 49187272
4-methylsulfanyl-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzenesulfonamide (PubChem CID 49187272) has the molecular formula C17H18N2O3S2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 4-methylsulfanyl-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-methylsulfanyl-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 49187272 |
| Molecular Formula | C17H18N2O3S2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 4-methylsulfanyl-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzenesulfonamide |
| SMILES | CSc1ccc(S(=O)(=O)Nc2cccc(N3CCCC3=O)c2)cc1 |
| InChI | InChI=1S/C17H18N2O3S2/c1-23-15-7-9-16(10-8-15)24(21,22)18-13-4-2-5-14(12-13)19-11-3-6-17(19)20/h2,4-5,7-10,12,18H,3,6,11H2,1H3 |
| InChIKey | LMEWYNXCCPOMLP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |