C16H18ClN3O4S2 — CID 53024673
2-(azepan-1-yl)-5-[(5-chlorothiophen-2-yl)sulfonylamino]pyridine-3-carboxylic acid (PubChem CID 53024673) has the molecular formula C16H18ClN3O4S2 and a molecular weight of 415.92 g/mol. Its IUPAC name is 2-(azepan-1-yl)-5-[(5-chlorothiophen-2-yl)sulfonylamino]pyridine-3-carboxylic acid.
| Compound Name | 2-(azepan-1-yl)-5-[(5-chlorothiophen-2-yl)sulfonylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 53024673 |
| Molecular Formula | C16H18ClN3O4S2 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 2-(azepan-1-yl)-5-[(5-chlorothiophen-2-yl)sulfonylamino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc(NS(=O)(=O)c2ccc(Cl)s2)cnc1N1CCCCCC1 |
| InChI | InChI=1S/C16H18ClN3O4S2/c17-13-5-6-14(25-13)26(23,24)19-11-9-12(16(21)22)15(18-10-11)20-7-3-1-2-4-8-20/h5-6,9-10,19H,1-4,7-8H2,(H,21,22) |
| InChIKey | RKJHFVIQNPVWGA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |