C14H14ClN3O4S2 — CID 53024698
5-[(5-chlorothiophen-2-yl)sulfonylamino]-2-pyrrolidin-1-ylpyridine-3-carboxylic acid (PubChem CID 53024698) has the molecular formula C14H14ClN3O4S2 and a molecular weight of 387.87 g/mol. Its IUPAC name is 5-[(5-chlorothiophen-2-yl)sulfonylamino]-2-pyrrolidin-1-ylpyridine-3-carboxylic acid.
| Compound Name | 5-[(5-chlorothiophen-2-yl)sulfonylamino]-2-pyrrolidin-1-ylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 53024698 |
| Molecular Formula | C14H14ClN3O4S2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 5-[(5-chlorothiophen-2-yl)sulfonylamino]-2-pyrrolidin-1-ylpyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc(NS(=O)(=O)c2ccc(Cl)s2)cnc1N1CCCC1 |
| InChI | InChI=1S/C14H14ClN3O4S2/c15-11-3-4-12(23-11)24(21,22)17-9-7-10(14(19)20)13(16-8-9)18-5-1-2-6-18/h3-4,7-8,17H,1-2,5-6H2,(H,19,20) |
| InChIKey | NIBGUCYBYBOTSX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |