C18H17ClN4O3S2 — CID 22576140
5-chloro-N-[3-(6-morpholin-4-ylpyridazin-3-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 22576140) has the molecular formula C18H17ClN4O3S2 and a molecular weight of 436.95 g/mol. Its IUPAC name is 5-chloro-N-[3-(6-morpholin-4-ylpyridazin-3-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[3-(6-morpholin-4-ylpyridazin-3-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22576140 |
| Molecular Formula | C18H17ClN4O3S2 |
| Molecular Weight | 436.95 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 5-chloro-N-[3-(6-morpholin-4-ylpyridazin-3-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(-c2ccc(N3CCOCC3)nn2)c1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H17ClN4O3S2/c19-16-5-7-18(27-16)28(24,25)22-14-3-1-2-13(12-14)15-4-6-17(21-20-15)23-8-10-26-11-9-23/h1-7,12,22H,8-11H2 |
| InChIKey | HOBMPUOKMFOYCH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.95 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |