C19H20N4O2S2 — CID 7520734
N-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 7520734) has the molecular formula C19H20N4O2S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 7520734 |
| Molecular Formula | C19H20N4O2S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | N-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(-c2ccc(N3CCCCC3)nn2)c1)c1cccs1 |
| InChI | InChI=1S/C19H20N4O2S2/c24-27(25,19-8-5-13-26-19)22-16-7-4-6-15(14-16)17-9-10-18(21-20-17)23-11-2-1-3-12-23/h4-10,13-14,22H,1-3,11-12H2 |
| InChIKey | HGINFPWPZIZXJL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |