C20H21N5OS — CID 43991871
1-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]-3-thiophen-2-ylurea (PubChem CID 43991871) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is 1-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]-3-thiophen-2-ylurea.
| Compound Name | 1-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]-3-thiophen-2-ylurea |
|---|---|
| PubChem CID | 43991871 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]-3-thiophen-2-ylurea |
| SMILES | O=C(Nc1cccc(-c2ccc(N3CCCCC3)nn2)c1)Nc1cccs1 |
| InChI | InChI=1S/C20H21N5OS/c26-20(22-19-8-5-13-27-19)21-16-7-4-6-15(14-16)17-9-10-18(24-23-17)25-11-2-1-3-12-25/h4-10,13-14H,1-3,11-12H2,(H2,21,22,26) |
| InChIKey | KPZFJYJOINEARW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |