C23H23F2N5O — CID 43991412
1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(3,4-difluorophenyl)urea (PubChem CID 43991412) has the molecular formula C23H23F2N5O and a molecular weight of 423.47 g/mol. Its IUPAC name is 1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(3,4-difluorophenyl)urea.
| Compound Name | 1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(3,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 43991412 |
| Molecular Formula | C23H23F2N5O |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(3,4-difluorophenyl)urea |
| SMILES | O=C(Nc1cccc(-c2ccc(N3CCCCCC3)nn2)c1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C23H23F2N5O/c24-19-9-8-18(15-20(19)25)27-23(31)26-17-7-5-6-16(14-17)21-10-11-22(29-28-21)30-12-3-1-2-4-13-30/h5-11,14-15H,1-4,12-13H2,(H2,26,27,31) |
| InChIKey | KLMAJAQEKXECAG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |