C21H19F2N5O — CID 43991730
1-(2,5-difluorophenyl)-3-[3-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]urea (PubChem CID 43991730) has the molecular formula C21H19F2N5O and a molecular weight of 395.41 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-[3-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]urea.
| Compound Name | 1-(2,5-difluorophenyl)-3-[3-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 43991730 |
| Molecular Formula | C21H19F2N5O |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-[3-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]urea |
| SMILES | O=C(Nc1cccc(-c2ccc(N3CCCC3)nn2)c1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C21H19F2N5O/c22-15-6-7-17(23)19(13-15)25-21(29)24-16-5-3-4-14(12-16)18-8-9-20(27-26-18)28-10-1-2-11-28/h3-9,12-13H,1-2,10-11H2,(H2,24,25,29) |
| InChIKey | NXCJOUQOMPUISU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |