C25H29N5O — CID 43991451
1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(2,5-dimethylphenyl)urea (PubChem CID 43991451) has the molecular formula C25H29N5O and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(2,5-dimethylphenyl)urea.
| Compound Name | 1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(2,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 43991451 |
| Molecular Formula | C25H29N5O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(2,5-dimethylphenyl)urea |
| SMILES | Cc1ccc(C)c(NC(=O)Nc2cccc(-c3ccc(N4CCCCCC4)nn3)c2)c1 |
| InChI | InChI=1S/C25H29N5O/c1-18-10-11-19(2)23(16-18)27-25(31)26-21-9-7-8-20(17-21)22-12-13-24(29-28-22)30-14-5-3-4-6-15-30/h7-13,16-17H,3-6,14-15H2,1-2H3,(H2,26,27,31) |
| InChIKey | RAMGVWNDOOPADW-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |