C24H26ClN5O — CID 43991436
1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(3-chloro-2-methylphenyl)urea (PubChem CID 43991436) has the molecular formula C24H26ClN5O and a molecular weight of 435.96 g/mol. Its IUPAC name is 1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(3-chloro-2-methylphenyl)urea.
| Compound Name | 1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(3-chloro-2-methylphenyl)urea |
|---|---|
| PubChem CID | 43991436 |
| Molecular Formula | C24H26ClN5O |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(3-chloro-2-methylphenyl)urea |
| SMILES | Cc1c(Cl)cccc1NC(=O)Nc1cccc(-c2ccc(N3CCCCCC3)nn2)c1 |
| InChI | InChI=1S/C24H26ClN5O/c1-17-20(25)10-7-11-21(17)27-24(31)26-19-9-6-8-18(16-19)22-12-13-23(29-28-22)30-14-4-2-3-5-15-30/h6-13,16H,2-5,14-15H2,1H3,(H2,26,27,31) |
| InChIKey | QYKAIZXIBLLYGW-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |