C21H20ClN5O2 — CID 43991973
1-(2-chlorophenyl)-3-[3-(6-morpholin-4-ylpyridazin-3-yl)phenyl]urea (PubChem CID 43991973) has the molecular formula C21H20ClN5O2 and a molecular weight of 409.88 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[3-(6-morpholin-4-ylpyridazin-3-yl)phenyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[3-(6-morpholin-4-ylpyridazin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 43991973 |
| Molecular Formula | C21H20ClN5O2 |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[3-(6-morpholin-4-ylpyridazin-3-yl)phenyl]urea |
| SMILES | O=C(Nc1cccc(-c2ccc(N3CCOCC3)nn2)c1)Nc1ccccc1Cl |
| InChI | InChI=1S/C21H20ClN5O2/c22-17-6-1-2-7-19(17)24-21(28)23-16-5-3-4-15(14-16)18-8-9-20(26-25-18)27-10-12-29-13-11-27/h1-9,14H,10-13H2,(H2,23,24,28) |
| InChIKey | HDCUHYSDVCTUIC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |