C23H25N5O — CID 43991408
1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-phenylurea (PubChem CID 43991408) has the molecular formula C23H25N5O and a molecular weight of 387.49 g/mol. Its IUPAC name is 1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-phenylurea.
| Compound Name | 1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 43991408 |
| Molecular Formula | C23H25N5O |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1cccc(-c2ccc(N3CCCCCC3)nn2)c1 |
| InChI | InChI=1S/C23H25N5O/c29-23(24-19-10-4-3-5-11-19)25-20-12-8-9-18(17-20)21-13-14-22(27-26-21)28-15-6-1-2-7-16-28/h3-5,8-14,17H,1-2,6-7,15-16H2,(H2,24,25,29) |
| InChIKey | HLHSTEYOTNYNCS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |