C23H23N5O3 — CID 43991826
1-(1,3-benzodioxol-5-yl)-3-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]urea (PubChem CID 43991826) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 43991826 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]urea |
| SMILES | O=C(Nc1cccc(-c2ccc(N3CCCCC3)nn2)c1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H23N5O3/c29-23(25-18-7-9-20-21(14-18)31-15-30-20)24-17-6-4-5-16(13-17)19-8-10-22(27-26-19)28-11-2-1-3-12-28/h4-10,13-14H,1-3,11-12,15H2,(H2,24,25,29) |
| InChIKey | MMZNJXINAYOYBR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |