C22H21N5O3 — CID 43992554
1-(1,3-benzodioxol-5-yl)-3-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]urea (PubChem CID 43992554) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 43992554 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(-c2ccc(N3CCCC3)nn2)cc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H21N5O3/c28-22(24-17-7-9-19-20(13-17)30-14-29-19)23-16-5-3-15(4-6-16)18-8-10-21(26-25-18)27-11-1-2-12-27/h3-10,13H,1-2,11-12,14H2,(H2,23,24,28) |
| InChIKey | SESHDWMMRYDOBB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |