C26H31N5O — CID 43991446
1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(4-propan-2-ylphenyl)urea (PubChem CID 43991446) has the molecular formula C26H31N5O and a molecular weight of 429.57 g/mol. Its IUPAC name is 1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 43991446 |
| Molecular Formula | C26H31N5O |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(4-propan-2-ylphenyl)urea |
| SMILES | CC(C)c1ccc(NC(=O)Nc2cccc(-c3ccc(N4CCCCCC4)nn3)c2)cc1 |
| InChI | InChI=1S/C26H31N5O/c1-19(2)20-10-12-22(13-11-20)27-26(32)28-23-9-7-8-21(18-23)24-14-15-25(30-29-24)31-16-5-3-4-6-17-31/h7-15,18-19H,3-6,16-17H2,1-2H3,(H2,27,28,32) |
| InChIKey | KWJSGTSELYGVIM-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |