C24H27N5O2 — CID 43991414
1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(3-methoxyphenyl)urea (PubChem CID 43991414) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 43991414 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 1-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)Nc2cccc(-c3ccc(N4CCCCCC4)nn3)c2)c1 |
| InChI | InChI=1S/C24H27N5O2/c1-31-21-11-7-10-20(17-21)26-24(30)25-19-9-6-8-18(16-19)22-12-13-23(28-27-22)29-14-4-2-3-5-15-29/h6-13,16-17H,2-5,14-15H2,1H3,(H2,25,26,30) |
| InChIKey | NJANXFMYXDHASH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |