C23H25N5O3 — CID 43991686
1-(2,4-dimethoxyphenyl)-3-[3-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]urea (PubChem CID 43991686) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-[3-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]urea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-[3-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 43991686 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-[3-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]urea |
| SMILES | COc1ccc(NC(=O)Nc2cccc(-c3ccc(N4CCCC4)nn3)c2)c(OC)c1 |
| InChI | InChI=1S/C23H25N5O3/c1-30-18-8-9-20(21(15-18)31-2)25-23(29)24-17-7-5-6-16(14-17)19-10-11-22(27-26-19)28-12-3-4-13-28/h5-11,14-15H,3-4,12-13H2,1-2H3,(H2,24,25,29) |
| InChIKey | IUKAXFJFJDRIMD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |