C21H20Cl2N4O2S — CID 41006096
2,5-dichloro-N-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]benzenesulfonamide (PubChem CID 41006096) has the molecular formula C21H20Cl2N4O2S and a molecular weight of 463.39 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 41006096 |
| Molecular Formula | C21H20Cl2N4O2S |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 2,5-dichloro-N-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(-c2ccc(N3CCCCC3)nn2)c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H20Cl2N4O2S/c22-16-7-8-18(23)20(14-16)30(28,29)26-17-6-4-5-15(13-17)19-9-10-21(25-24-19)27-11-2-1-3-12-27/h4-10,13-14,26H,1-3,11-12H2 |
| InChIKey | NNDRMFFDVUJOIZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |