C22H21Cl3N4O2S — CID 121031462
N-[4-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-2,4,5-trichlorobenzenesulfonamide (PubChem CID 121031462) has the molecular formula C22H21Cl3N4O2S and a molecular weight of 511.86 g/mol. Its IUPAC name is N-[4-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-2,4,5-trichlorobenzenesulfonamide.
| Compound Name | N-[4-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-2,4,5-trichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 121031462 |
| Molecular Formula | C22H21Cl3N4O2S |
| Molecular Weight | 511.86 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | N-[4-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-2,4,5-trichlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-c2ccc(N3CCCCCC3)nn2)cc1)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C22H21Cl3N4O2S/c23-17-13-19(25)21(14-18(17)24)32(30,31)28-16-7-5-15(6-8-16)20-9-10-22(27-26-20)29-11-3-1-2-4-12-29/h5-10,13-14,28H,1-4,11-12H2 |
| InChIKey | RANALSWRSVZPIA-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.86 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|