C20H18Cl2N4O2S — CID 41349100
2,3-dichloro-N-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]benzenesulfonamide (PubChem CID 41349100) has the molecular formula C20H18Cl2N4O2S and a molecular weight of 449.36 g/mol. Its IUPAC name is 2,3-dichloro-N-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]benzenesulfonamide.
| Compound Name | 2,3-dichloro-N-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 41349100 |
| Molecular Formula | C20H18Cl2N4O2S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 2,3-dichloro-N-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-c2ccc(N3CCCC3)nn2)cc1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C20H18Cl2N4O2S/c21-16-4-3-5-18(20(16)22)29(27,28)25-15-8-6-14(7-9-15)17-10-11-19(24-23-17)26-12-1-2-13-26/h3-11,25H,1-2,12-13H2 |
| InChIKey | AMYHTXWEXORDBZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |