C19H17Cl2N3O3S — CID 41349149
2,3-dichloro-N-[4-(6-propoxypyridazin-3-yl)phenyl]benzenesulfonamide (PubChem CID 41349149) has the molecular formula C19H17Cl2N3O3S and a molecular weight of 438.34 g/mol. Its IUPAC name is 2,3-dichloro-N-[4-(6-propoxypyridazin-3-yl)phenyl]benzenesulfonamide.
| Compound Name | 2,3-dichloro-N-[4-(6-propoxypyridazin-3-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 41349149 |
| Molecular Formula | C19H17Cl2N3O3S |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 2,3-dichloro-N-[4-(6-propoxypyridazin-3-yl)phenyl]benzenesulfonamide |
| SMILES | CCCOc1ccc(-c2ccc(NS(=O)(=O)c3cccc(Cl)c3Cl)cc2)nn1 |
| InChI | InChI=1S/C19H17Cl2N3O3S/c1-2-12-27-18-11-10-16(22-23-18)13-6-8-14(9-7-13)24-28(25,26)17-5-3-4-15(20)19(17)21/h3-11,24H,2,12H2,1H3 |
| InChIKey | CVYHCJJXIXVEKL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |