C20H20ClN3O3S — CID 43985825
2-chloro-N-[3-[6-(2-methylpropoxy)pyridazin-3-yl]phenyl]benzenesulfonamide (PubChem CID 43985825) has the molecular formula C20H20ClN3O3S and a molecular weight of 417.92 g/mol. Its IUPAC name is 2-chloro-N-[3-[6-(2-methylpropoxy)pyridazin-3-yl]phenyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[3-[6-(2-methylpropoxy)pyridazin-3-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43985825 |
| Molecular Formula | C20H20ClN3O3S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 2-chloro-N-[3-[6-(2-methylpropoxy)pyridazin-3-yl]phenyl]benzenesulfonamide |
| SMILES | CC(C)COc1ccc(-c2cccc(NS(=O)(=O)c3ccccc3Cl)c2)nn1 |
| InChI | InChI=1S/C20H20ClN3O3S/c1-14(2)13-27-20-11-10-18(22-23-20)15-6-5-7-16(12-15)24-28(25,26)19-9-4-3-8-17(19)21/h3-12,14,24H,13H2,1-2H3 |
| InChIKey | HDHQLDIVWMGGET-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |