C18H15Cl2N3O4S2 — CID 41159256
2,5-dichloro-N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]benzenesulfonamide (PubChem CID 41159256) has the molecular formula C18H15Cl2N3O4S2 and a molecular weight of 472.38 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 41159256 |
| Molecular Formula | C18H15Cl2N3O4S2 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 470.99 |
| IUPAC Name | 2,5-dichloro-N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]benzenesulfonamide |
| SMILES | CCS(=O)(=O)c1ccc(-c2cccc(NS(=O)(=O)c3cc(Cl)ccc3Cl)c2)nn1 |
| InChI | InChI=1S/C18H15Cl2N3O4S2/c1-2-28(24,25)18-9-8-16(21-22-18)12-4-3-5-14(10-12)23-29(26,27)17-11-13(19)6-7-15(17)20/h3-11,23H,2H2,1H3 |
| InChIKey | DJIUXPIRIULQRL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |