C17H13Cl2N3O4S2 — CID 18569022
3,4-dichloro-N-[3-(6-methylsulfonylpyridazin-3-yl)phenyl]benzenesulfonamide (PubChem CID 18569022) has the molecular formula C17H13Cl2N3O4S2 and a molecular weight of 458.35 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-(6-methylsulfonylpyridazin-3-yl)phenyl]benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-[3-(6-methylsulfonylpyridazin-3-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 18569022 |
| Molecular Formula | C17H13Cl2N3O4S2 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 456.97 |
| IUPAC Name | 3,4-dichloro-N-[3-(6-methylsulfonylpyridazin-3-yl)phenyl]benzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(-c2cccc(NS(=O)(=O)c3ccc(Cl)c(Cl)c3)c2)nn1 |
| InChI | InChI=1S/C17H13Cl2N3O4S2/c1-27(23,24)17-8-7-16(20-21-17)11-3-2-4-12(9-11)22-28(25,26)13-5-6-14(18)15(19)10-13/h2-10,22H,1H3 |
| InChIKey | FDGBGEBNCQWYSF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |