C12H13N3O4S2 — CID 26842222
N-[3-(6-methylsulfonylpyridazin-3-yl)phenyl]methanesulfonamide (PubChem CID 26842222) has the molecular formula C12H13N3O4S2 and a molecular weight of 327.39 g/mol. Its IUPAC name is N-[3-(6-methylsulfonylpyridazin-3-yl)phenyl]methanesulfonamide.
| Compound Name | N-[3-(6-methylsulfonylpyridazin-3-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 26842222 |
| Molecular Formula | C12H13N3O4S2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | N-[3-(6-methylsulfonylpyridazin-3-yl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(-c2ccc(S(C)(=O)=O)nn2)c1 |
| InChI | InChI=1S/C12H13N3O4S2/c1-20(16,17)12-7-6-11(13-14-12)9-4-3-5-10(8-9)15-21(2,18)19/h3-8,15H,1-2H3 |
| InChIKey | PVDLQSWIOPKYBU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |