C24H21N3O4S2 — CID 41159266
N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]-4-phenylbenzenesulfonamide (PubChem CID 41159266) has the molecular formula C24H21N3O4S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]-4-phenylbenzenesulfonamide.
| Compound Name | N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 41159266 |
| Molecular Formula | C24H21N3O4S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]-4-phenylbenzenesulfonamide |
| SMILES | CCS(=O)(=O)c1ccc(-c2cccc(NS(=O)(=O)c3ccc(-c4ccccc4)cc3)c2)nn1 |
| InChI | InChI=1S/C24H21N3O4S2/c1-2-32(28,29)24-16-15-23(25-26-24)20-9-6-10-21(17-20)27-33(30,31)22-13-11-19(12-14-22)18-7-4-3-5-8-18/h3-17,27H,2H2,1H3 |
| InChIKey | ACECOFNIMAHGQC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |