C19H16BrN3O3S — CID 26841808
2-bromo-N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]benzamide (PubChem CID 26841808) has the molecular formula C19H16BrN3O3S and a molecular weight of 446.33 g/mol. Its IUPAC name is 2-bromo-N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]benzamide.
| Compound Name | 2-bromo-N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 26841808 |
| Molecular Formula | C19H16BrN3O3S |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.01 |
| IUPAC Name | 2-bromo-N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]benzamide |
| SMILES | CCS(=O)(=O)c1ccc(-c2cccc(NC(=O)c3ccccc3Br)c2)nn1 |
| InChI | InChI=1S/C19H16BrN3O3S/c1-2-27(25,26)18-11-10-17(22-23-18)13-6-5-7-14(12-13)21-19(24)15-8-3-4-9-16(15)20/h3-12H,2H2,1H3,(H,21,24) |
| InChIKey | DMTQHXKIMPQBGU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |