C17H14BrN3O4S — CID 18567813
5-bromo-N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]furan-2-carboxamide (PubChem CID 18567813) has the molecular formula C17H14BrN3O4S and a molecular weight of 436.29 g/mol. Its IUPAC name is 5-bromo-N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 18567813 |
| Molecular Formula | C17H14BrN3O4S |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 434.99 |
| IUPAC Name | 5-bromo-N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]furan-2-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(-c2cccc(NC(=O)c3ccc(Br)o3)c2)nn1 |
| InChI | InChI=1S/C17H14BrN3O4S/c1-2-26(23,24)16-9-6-13(20-21-16)11-4-3-5-12(10-11)19-17(22)14-7-8-15(18)25-14/h3-10H,2H2,1H3,(H,19,22) |
| InChIKey | KQDRHIRVZUQUFL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |