C20H20N4O4S — CID 41213037
2-ethoxy-N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]pyridine-3-carboxamide (PubChem CID 41213037) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is 2-ethoxy-N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]pyridine-3-carboxamide.
| Compound Name | 2-ethoxy-N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 41213037 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 2-ethoxy-N-[3-(6-ethylsulfonylpyridazin-3-yl)phenyl]pyridine-3-carboxamide |
| SMILES | CCOc1ncccc1C(=O)Nc1cccc(-c2ccc(S(=O)(=O)CC)nn2)c1 |
| InChI | InChI=1S/C20H20N4O4S/c1-3-28-20-16(9-6-12-21-20)19(25)22-15-8-5-7-14(13-15)17-10-11-18(24-23-17)29(26,27)4-2/h5-13H,3-4H2,1-2H3,(H,22,25) |
| InChIKey | WLPYLTLOLJYVQT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |