C24H21N3O6S — CID 41213186
8-ethoxy-N-[4-(6-ethylsulfonylpyridazin-3-yl)phenyl]-2-oxochromene-3-carboxamide (PubChem CID 41213186) has the molecular formula C24H21N3O6S and a molecular weight of 479.51 g/mol. Its IUPAC name is 8-ethoxy-N-[4-(6-ethylsulfonylpyridazin-3-yl)phenyl]-2-oxochromene-3-carboxamide.
| Compound Name | 8-ethoxy-N-[4-(6-ethylsulfonylpyridazin-3-yl)phenyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 41213186 |
| Molecular Formula | C24H21N3O6S |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 8-ethoxy-N-[4-(6-ethylsulfonylpyridazin-3-yl)phenyl]-2-oxochromene-3-carboxamide |
| SMILES | CCOc1cccc2cc(C(=O)Nc3ccc(-c4ccc(S(=O)(=O)CC)nn4)cc3)c(=O)oc12 |
| InChI | InChI=1S/C24H21N3O6S/c1-3-32-20-7-5-6-16-14-18(24(29)33-22(16)20)23(28)25-17-10-8-15(9-11-17)19-12-13-21(27-26-19)34(30,31)4-2/h5-14H,3-4H2,1-2H3,(H,25,28) |
| InChIKey | LUNQJFIZPQBUQZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|