C27H19FN2O4S — CID 121148570
8-ethoxy-N-[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]phenyl]-2-oxochromene-3-carboxamide (PubChem CID 121148570) has the molecular formula C27H19FN2O4S and a molecular weight of 486.52 g/mol. Its IUPAC name is 8-ethoxy-N-[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]phenyl]-2-oxochromene-3-carboxamide.
| Compound Name | 8-ethoxy-N-[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]phenyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 121148570 |
| Molecular Formula | C27H19FN2O4S |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 8-ethoxy-N-[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]phenyl]-2-oxochromene-3-carboxamide |
| SMILES | CCOc1cccc2cc(C(=O)Nc3ccccc3-c3csc(-c4ccccc4F)n3)c(=O)oc12 |
| InChI | InChI=1S/C27H19FN2O4S/c1-2-33-23-13-7-8-16-14-19(27(32)34-24(16)23)25(31)29-21-12-6-4-10-18(21)22-15-35-26(30-22)17-9-3-5-11-20(17)28/h3-15H,2H2,1H3,(H,29,31) |
| InChIKey | SFKYYHDUCLRGQW-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|