C24H19FN2O3S — CID 121148552
N-[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]phenyl]-2,4-dimethoxybenzamide (PubChem CID 121148552) has the molecular formula C24H19FN2O3S and a molecular weight of 434.49 g/mol. Its IUPAC name is N-[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]phenyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]phenyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 121148552 |
| Molecular Formula | C24H19FN2O3S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | N-[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]phenyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2-c2csc(-c3ccccc3F)n2)c(OC)c1 |
| InChI | InChI=1S/C24H19FN2O3S/c1-29-15-11-12-18(22(13-15)30-2)23(28)26-20-10-6-4-8-17(20)21-14-31-24(27-21)16-7-3-5-9-19(16)25/h3-14H,1-2H3,(H,26,28) |
| InChIKey | XQOWQJHVGINGIC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |