C17H12FNO4 — CID 749756
N-(2-fluorophenyl)-8-methoxy-2-oxochromene-3-carboxamide (PubChem CID 749756) has the molecular formula C17H12FNO4 and a molecular weight of 313.28 g/mol. Its IUPAC name is N-(2-fluorophenyl)-8-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-(2-fluorophenyl)-8-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 749756 |
| Molecular Formula | C17H12FNO4 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | N-(2-fluorophenyl)-8-methoxy-2-oxochromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)Nc3ccccc3F)c(=O)oc12 |
| InChI | InChI=1S/C17H12FNO4/c1-22-14-8-4-5-10-9-11(17(21)23-15(10)14)16(20)19-13-7-3-2-6-12(13)18/h2-9H,1H3,(H,19,20) |
| InChIKey | IPYZBEYLZKNEQN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|