C24H17N3O4S — CID 121024370
8-ethoxy-2-oxo-N-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]chromene-3-carboxamide (PubChem CID 121024370) has the molecular formula C24H17N3O4S and a molecular weight of 443.48 g/mol. Its IUPAC name is 8-ethoxy-2-oxo-N-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]chromene-3-carboxamide.
| Compound Name | 8-ethoxy-2-oxo-N-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 121024370 |
| Molecular Formula | C24H17N3O4S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 8-ethoxy-2-oxo-N-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]chromene-3-carboxamide |
| SMILES | CCOc1cccc2cc(C(=O)Nc3ccc(-c4nc5cccnc5s4)cc3)c(=O)oc12 |
| InChI | InChI=1S/C24H17N3O4S/c1-2-30-19-7-3-5-15-13-17(24(29)31-20(15)19)21(28)26-16-10-8-14(9-11-16)22-27-18-6-4-12-25-23(18)32-22/h3-13H,2H2,1H3,(H,26,28) |
| InChIKey | IABUWACGQPEKIJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|