C19H11Cl2N3OS — CID 121024338
3,5-dichloro-N-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzamide (PubChem CID 121024338) has the molecular formula C19H11Cl2N3OS and a molecular weight of 400.29 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzamide.
| Compound Name | 3,5-dichloro-N-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 121024338 |
| Molecular Formula | C19H11Cl2N3OS |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | 3,5-dichloro-N-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2nc3cccnc3s2)cc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H11Cl2N3OS/c20-13-8-12(9-14(21)10-13)17(25)23-15-5-3-11(4-6-15)18-24-16-2-1-7-22-19(16)26-18/h1-10H,(H,23,25) |
| InChIKey | HXGAVYFJBFWANE-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |