C21H14ClN3OS — CID 121024334
(E)-3-(2-chlorophenyl)-N-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]prop-2-enamide (PubChem CID 121024334) has the molecular formula C21H14ClN3OS and a molecular weight of 391.88 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 121024334 |
| Molecular Formula | C21H14ClN3OS |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)Nc1ccc(-c2nc3cccnc3s2)cc1 |
| InChI | InChI=1S/C21H14ClN3OS/c22-17-5-2-1-4-14(17)9-12-19(26)24-16-10-7-15(8-11-16)20-25-18-6-3-13-23-21(18)27-20/h1-13H,(H,24,26)/b12-9+ |
| InChIKey | SNFGCSXFLCKGPU-FMIVXFBMSA-N |
| XLogP | 5.66 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|