C22H16ClN3OS — CID 121024942
(E)-3-(2-chlorophenyl)-N-[2-methyl-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]prop-2-enamide (PubChem CID 121024942) has the molecular formula C22H16ClN3OS and a molecular weight of 405.91 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[2-methyl-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[2-methyl-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 121024942 |
| Molecular Formula | C22H16ClN3OS |
| Molecular Weight | 405.91 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[2-methyl-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]prop-2-enamide |
| SMILES | Cc1c(NC(=O)/C=C/c2ccccc2Cl)cccc1-c1nc2cccnc2s1 |
| InChI | InChI=1S/C22H16ClN3OS/c1-14-16(21-26-19-10-5-13-24-22(19)28-21)7-4-9-18(14)25-20(27)12-11-15-6-2-3-8-17(15)23/h2-13H,1H3,(H,25,27)/b12-11+ |
| InChIKey | VJTWDTAGXTVQBH-VAWYXSNFSA-N |
| XLogP | 5.97 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.91 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|