C30H22Cl2N2O3 — CID 6242476
(E)-3-(2-chlorophenyl)-N-[4-[4-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]phenoxy]phenyl]prop-2-enamide (PubChem CID 6242476) has the molecular formula C30H22Cl2N2O3 and a molecular weight of 529.42 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[4-[4-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]phenoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[4-[4-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]phenoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 6242476 |
| Molecular Formula | C30H22Cl2N2O3 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 528.10 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[4-[4-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]phenoxy]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)Nc1ccc(Oc2ccc(NC(=O)/C=C/c3ccccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C30H22Cl2N2O3/c31-27-7-3-1-5-21(27)9-19-29(35)33-23-11-15-25(16-12-23)37-26-17-13-24(14-18-26)34-30(36)20-10-22-6-2-4-8-28(22)32/h1-20H,(H,33,35)(H,34,36)/b19-9+,20-10+ |
| InChIKey | DTNDNFKTLXRGEG-LQGKIZFRSA-N |
| XLogP | 8.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|