C15H10Cl3NO — CID 966103
3-(2-chlorophenyl)-N-(3,5-dichlorophenyl)prop-2-enamide (PubChem CID 966103) has the molecular formula C15H10Cl3NO and a molecular weight of 326.61 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-(3,5-dichlorophenyl)prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-(3,5-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 966103 |
| Molecular Formula | C15H10Cl3NO |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | 3-(2-chlorophenyl)-N-(3,5-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1Cl)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H10Cl3NO/c16-11-7-12(17)9-13(8-11)19-15(20)6-5-10-3-1-2-4-14(10)18/h1-9H,(H,19,20) |
| InChIKey | JFFUEVCRJRNIMC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|